C10H5NaO8 — CID 100958061
sodium 2,4,5-tricarboxybenzoate (PubChem CID 100958061) has the molecular formula C10H5NaO8 and a molecular weight of 276.13 g/mol. Its IUPAC name is sodium 2,4,5-tricarboxybenzoate.
| Compound Name | sodium 2,4,5-tricarboxybenzoate |
|---|---|
| PubChem CID | 100958061 |
| Molecular Formula | C10H5NaO8 |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | sodium 2,4,5-tricarboxybenzoate |
| SMILES | O=C([O-])c1cc(C(=O)O)c(C(=O)O)cc1C(=O)O.[Na+] |
| InChI | InChI=1S/C10H6O8.Na/c11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16;/h1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18);/q;+1/p-1 |
| InChIKey | SDEBIXIOBSCMLA-UHFFFAOYSA-M |
| XLogP | -3.85 |
| TPSA | 152.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |