C14H14N3O2- — CID 4113234
2-[(4,6-dimethylpyrimidin-2-yl)amino]-5-methylbenzoate (PubChem CID 4113234) has the molecular formula C14H14N3O2- and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-[(4,6-dimethylpyrimidin-2-yl)amino]-5-methylbenzoate.
| Compound Name | 2-[(4,6-dimethylpyrimidin-2-yl)amino]-5-methylbenzoate |
|---|---|
| PubChem CID | 4113234 |
| Molecular Formula | C14H14N3O2- |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-[(4,6-dimethylpyrimidin-2-yl)amino]-5-methylbenzoate |
| SMILES | Cc1ccc(Nc2nc(C)cc(C)n2)c(C(=O)[O-])c1 |
| InChI | InChI=1S/C14H15N3O2/c1-8-4-5-12(11(6-8)13(18)19)17-14-15-9(2)7-10(3)16-14/h4-7H,1-3H3,(H,18,19)(H,15,16,17)/p-1 |
| InChIKey | IYARHORIXYQXHL-UHFFFAOYSA-M |
| XLogP | 1.51 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |