C14H11N3O4-2 — CID 9150492
5-[(4,6-dimethylpyrimidin-2-yl)amino]benzene-1,3-dicarboxylate (PubChem CID 9150492) has the molecular formula C14H11N3O4-2 and a molecular weight of 285.26 g/mol. Its IUPAC name is 5-[(4,6-dimethylpyrimidin-2-yl)amino]benzene-1,3-dicarboxylate.
| Compound Name | 5-[(4,6-dimethylpyrimidin-2-yl)amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 9150492 |
| Molecular Formula | C14H11N3O4-2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 5-[(4,6-dimethylpyrimidin-2-yl)amino]benzene-1,3-dicarboxylate |
| SMILES | Cc1cc(C)nc(Nc2cc(C(=O)[O-])cc(C(=O)[O-])c2)n1 |
| InChI | InChI=1S/C14H13N3O4/c1-7-3-8(2)16-14(15-7)17-11-5-9(12(18)19)4-10(6-11)13(20)21/h3-6H,1-2H3,(H,18,19)(H,20,21)(H,15,16,17)/p-2 |
| InChIKey | KTWCNQKHXNEJOG-UHFFFAOYSA-L |
| XLogP | -0.44 |
| TPSA | 118.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |