C18H15N2O2- — CID 4137398
3-[(2,8-dimethylquinolin-4-yl)amino]benzoate (PubChem CID 4137398) has the molecular formula C18H15N2O2- and a molecular weight of 291.33 g/mol. Its IUPAC name is 3-[(2,8-dimethylquinolin-4-yl)amino]benzoate.
| Compound Name | 3-[(2,8-dimethylquinolin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 4137398 |
| Molecular Formula | C18H15N2O2- |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-[(2,8-dimethylquinolin-4-yl)amino]benzoate |
| SMILES | Cc1cc(Nc2cccc(C(=O)[O-])c2)c2cccc(C)c2n1 |
| InChI | InChI=1S/C18H16N2O2/c1-11-5-3-8-15-16(9-12(2)19-17(11)15)20-14-7-4-6-13(10-14)18(21)22/h3-10H,1-2H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | LRNZTGOCCMNPAA-UHFFFAOYSA-M |
| XLogP | 2.96 |
| TPSA | 65.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |