C18H17ClN2O2 — CID 2790119
3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid;hydrochloride (PubChem CID 2790119) has the molecular formula C18H17ClN2O2 and a molecular weight of 328.80 g/mol. Its IUPAC name is 3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid;hydrochloride.
| Compound Name | 3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 2790119 |
| Molecular Formula | C18H17ClN2O2 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid;hydrochloride |
| SMILES | Cc1cc(Nc2cccc(C(=O)O)c2)c2cccc(C)c2n1.Cl |
| InChI | InChI=1S/C18H16N2O2.ClH/c1-11-5-3-8-15-16(9-12(2)19-17(11)15)20-14-7-4-6-13(10-14)18(21)22;/h3-10H,1-2H3,(H,19,20)(H,21,22);1H |
| InChIKey | WYVLGTIYIDKBSL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |