C17H13N2O3- — CID 54698935
4-[(8-carboxy-2-methylquinolin-4-yl)amino]phenolate (PubChem CID 54698935) has the molecular formula C17H13N2O3- and a molecular weight of 293.30 g/mol. Its IUPAC name is 4-[(8-carboxy-2-methylquinolin-4-yl)amino]phenolate.
| Compound Name | 4-[(8-carboxy-2-methylquinolin-4-yl)amino]phenolate |
|---|---|
| PubChem CID | 54698935 |
| Molecular Formula | C17H13N2O3- |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 4-[(8-carboxy-2-methylquinolin-4-yl)amino]phenolate |
| SMILES | Cc1cc(Nc2ccc([O-])cc2)c2cccc(C(=O)O)c2n1 |
| InChI | InChI=1S/C17H14N2O3/c1-10-9-15(19-11-5-7-12(20)8-6-11)13-3-2-4-14(17(21)22)16(13)18-10/h2-9,20H,1H3,(H,18,19)(H,21,22)/p-1 |
| InChIKey | FZNNREDGYRSHPU-UHFFFAOYSA-M |
| XLogP | 3.06 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |