C17H17N3O3S — CID 14052838
4-[(8-methoxy-2-methylquinolin-4-yl)amino]benzenesulfonamide (PubChem CID 14052838) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 4-[(8-methoxy-2-methylquinolin-4-yl)amino]benzenesulfonamide.
| Compound Name | 4-[(8-methoxy-2-methylquinolin-4-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 14052838 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 4-[(8-methoxy-2-methylquinolin-4-yl)amino]benzenesulfonamide |
| SMILES | COc1cccc2c(Nc3ccc(S(N)(=O)=O)cc3)cc(C)nc12 |
| InChI | InChI=1S/C17H17N3O3S/c1-11-10-15(14-4-3-5-16(23-2)17(14)19-11)20-12-6-8-13(9-7-12)24(18,21)22/h3-10H,1-2H3,(H,19,20)(H2,18,21,22) |
| InChIKey | VFMPVYSDUBMLML-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |