C20H21N3O4S2 — CID 46302335
2-(8-methoxy-4-methylquinolin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)propanamide (PubChem CID 46302335) has the molecular formula C20H21N3O4S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-(8-methoxy-4-methylquinolin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 2-(8-methoxy-4-methylquinolin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 46302335 |
| Molecular Formula | C20H21N3O4S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 2-(8-methoxy-4-methylquinolin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)propanamide |
| SMILES | COc1cccc2c(C)cc(SC(C)C(=O)Nc3ccc(S(N)(=O)=O)cc3)nc12 |
| InChI | InChI=1S/C20H21N3O4S2/c1-12-11-18(23-19-16(12)5-4-6-17(19)27-3)28-13(2)20(24)22-14-7-9-15(10-8-14)29(21,25)26/h4-11,13H,1-3H3,(H,22,24)(H2,21,25,26) |
| InChIKey | FMLLAXJBSAFBDR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |