C19H22Cl2N2O — CID 45125627
N-(2-ethylphenyl)-8-methoxy-2-methylquinolin-4-amine;dihydrochloride (PubChem CID 45125627) has the molecular formula C19H22Cl2N2O and a molecular weight of 365.30 g/mol. Its IUPAC name is N-(2-ethylphenyl)-8-methoxy-2-methylquinolin-4-amine;dihydrochloride.
| Compound Name | N-(2-ethylphenyl)-8-methoxy-2-methylquinolin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 45125627 |
| Molecular Formula | C19H22Cl2N2O |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-(2-ethylphenyl)-8-methoxy-2-methylquinolin-4-amine;dihydrochloride |
| SMILES | CCc1ccccc1Nc1cc(C)nc2c(OC)cccc12.Cl.Cl |
| InChI | InChI=1S/C19H20N2O.2ClH/c1-4-14-8-5-6-10-16(14)21-17-12-13(2)20-19-15(17)9-7-11-18(19)22-3;;/h5-12H,4H2,1-3H3,(H,20,21);2*1H |
| InChIKey | XEMKUXNFXHUPMS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |