C18H26N2O2 — CID 133459634
8-methoxy-N-(4-methoxy-2,2-dimethylbutyl)-2-methylquinolin-4-amine (PubChem CID 133459634) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 8-methoxy-N-(4-methoxy-2,2-dimethylbutyl)-2-methylquinolin-4-amine.
| Compound Name | 8-methoxy-N-(4-methoxy-2,2-dimethylbutyl)-2-methylquinolin-4-amine |
|---|---|
| PubChem CID | 133459634 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 8-methoxy-N-(4-methoxy-2,2-dimethylbutyl)-2-methylquinolin-4-amine |
| SMILES | COCCC(C)(C)CNc1cc(C)nc2c(OC)cccc12 |
| InChI | InChI=1S/C18H26N2O2/c1-13-11-15(19-12-18(2,3)9-10-21-4)14-7-6-8-16(22-5)17(14)20-13/h6-8,11H,9-10,12H2,1-5H3,(H,19,20) |
| InChIKey | RPJSTKMXRXKYAS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |