C17H23N3O3 — CID 133459651
N-(4-methoxy-2,2-dimethylbutyl)-2-methyl-8-nitroquinolin-4-amine (PubChem CID 133459651) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-(4-methoxy-2,2-dimethylbutyl)-2-methyl-8-nitroquinolin-4-amine.
| Compound Name | N-(4-methoxy-2,2-dimethylbutyl)-2-methyl-8-nitroquinolin-4-amine |
|---|---|
| PubChem CID | 133459651 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-(4-methoxy-2,2-dimethylbutyl)-2-methyl-8-nitroquinolin-4-amine |
| SMILES | COCCC(C)(C)CNc1cc(C)nc2c([N+](=O)[O-])cccc12 |
| InChI | InChI=1S/C17H23N3O3/c1-12-10-14(18-11-17(2,3)8-9-23-4)13-6-5-7-15(20(21)22)16(13)19-12/h5-7,10H,8-9,11H2,1-4H3,(H,18,19) |
| InChIKey | SNOXPKUPUVYPIY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|