C18H15F2N3O3 — CID 133437468
1-(2,6-difluorophenyl)-2-[(2-methyl-8-nitroquinolin-4-yl)amino]ethanol (PubChem CID 133437468) has the molecular formula C18H15F2N3O3 and a molecular weight of 359.33 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-2-[(2-methyl-8-nitroquinolin-4-yl)amino]ethanol.
| Compound Name | 1-(2,6-difluorophenyl)-2-[(2-methyl-8-nitroquinolin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 133437468 |
| Molecular Formula | C18H15F2N3O3 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 1-(2,6-difluorophenyl)-2-[(2-methyl-8-nitroquinolin-4-yl)amino]ethanol |
| SMILES | Cc1cc(NCC(O)c2c(F)cccc2F)c2cccc([N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C18H15F2N3O3/c1-10-8-14(11-4-2-7-15(23(25)26)18(11)22-10)21-9-16(24)17-12(19)5-3-6-13(17)20/h2-8,16,24H,9H2,1H3,(H,21,22) |
| InChIKey | ZICFWZFYGKARPG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|