C16H22N4O2 — CID 133436966
1-N,1-N-dimethyl-3-N-(2-methyl-8-nitroquinolin-4-yl)butane-1,3-diamine (PubChem CID 133436966) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-N,1-N-dimethyl-3-N-(2-methyl-8-nitroquinolin-4-yl)butane-1,3-diamine.
| Compound Name | 1-N,1-N-dimethyl-3-N-(2-methyl-8-nitroquinolin-4-yl)butane-1,3-diamine |
|---|---|
| PubChem CID | 133436966 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1-N,1-N-dimethyl-3-N-(2-methyl-8-nitroquinolin-4-yl)butane-1,3-diamine |
| SMILES | Cc1cc(NC(C)CCN(C)C)c2cccc([N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C16H22N4O2/c1-11(8-9-19(3)4)17-14-10-12(2)18-16-13(14)6-5-7-15(16)20(21)22/h5-7,10-11H,8-9H2,1-4H3,(H,17,18) |
| InChIKey | UWNASPRKLYLYHJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|