C18H16FN3O3 — CID 133436618
1-(2-fluorophenyl)-2-[(2-methyl-8-nitroquinolin-4-yl)amino]ethanol (PubChem CID 133436618) has the molecular formula C18H16FN3O3 and a molecular weight of 341.34 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-2-[(2-methyl-8-nitroquinolin-4-yl)amino]ethanol.
| Compound Name | 1-(2-fluorophenyl)-2-[(2-methyl-8-nitroquinolin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 133436618 |
| Molecular Formula | C18H16FN3O3 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1-(2-fluorophenyl)-2-[(2-methyl-8-nitroquinolin-4-yl)amino]ethanol |
| SMILES | Cc1cc(NCC(O)c2ccccc2F)c2cccc([N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C18H16FN3O3/c1-11-9-15(13-6-4-8-16(22(24)25)18(13)21-11)20-10-17(23)12-5-2-3-7-14(12)19/h2-9,17,23H,10H2,1H3,(H,20,21) |
| InChIKey | SUOAYPPKESWCSS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|