3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid

C18H16N2O2 — CID 702836

IUPAC3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid
SMILESCc1cc(Nc2cccc(C(=O)O)c2)c2cccc(C)c2n1
InChIInChI=1S/C18H16N2O2/c1-11-5-3-8-15-16(9-12(2)19-17(11)15)20-14-7-4-6-13(10-14)18(21)22/h3-10H,1-2H3,(H,19,20)(H,21,22)
InChIKeyLRNZTGOCCMNPAA-UHFFFAOYSA-N
MW292.34 g/mol
LogP4.29
Rot. Bonds3

About 3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid

3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid (PubChem CID 702836) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid.

Molecular Properties

Compound Name3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid
PubChem CID702836
Molecular FormulaC18H16N2O2
Molecular Weight292.34 g/mol
Exact Mass292.12
IUPAC Name3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid
SMILESCc1cc(Nc2cccc(C(=O)O)c2)c2cccc(C)c2n1
InChIInChI=1S/C18H16N2O2/c1-11-5-3-8-15-16(9-12(2)19-17(11)15)20-14-7-4-6-13(10-14)18(21)22/h3-10H,1-2H3,(H,19,20)(H,21,22)
InChIKeyLRNZTGOCCMNPAA-UHFFFAOYSA-N
XLogP4.29
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.34
LogP ≤ 54.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid?
The IUPAC name of 3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid (CID 702836) is 3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid.
What is the SMILES notation for 3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid?
The canonical SMILES for 3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid is Cc1cc(Nc2cccc(C(=O)O)c2)c2cccc(C)c2n1.
What is the InChIKey of 3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid?
The InChIKey is LRNZTGOCCMNPAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O2/c1-11-5-3-8-15-16(9-12(2)19-17(11)15)20-14-7-4-6-13(10-14)18(21)22/h3-10H,1-2H3,(H,19,20)(H,21,22).
What are the key properties of 3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid?
3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid has a molecular weight of 292.34 g/mol, XLogP of 4.29, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,8-dimethylquinolin-4-yl)amino]benzoic acid is sourced from PubChem (CID 702836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).