C19H21ClN2O — CID 2790115
N-(4-ethoxyphenyl)-2,8-dimethylquinolin-4-amine;hydrochloride (PubChem CID 2790115) has the molecular formula C19H21ClN2O and a molecular weight of 328.84 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2,8-dimethylquinolin-4-amine;hydrochloride.
| Compound Name | N-(4-ethoxyphenyl)-2,8-dimethylquinolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 2790115 |
| Molecular Formula | C19H21ClN2O |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | N-(4-ethoxyphenyl)-2,8-dimethylquinolin-4-amine;hydrochloride |
| SMILES | CCOc1ccc(Nc2cc(C)nc3c(C)cccc23)cc1.Cl |
| InChI | InChI=1S/C19H20N2O.ClH/c1-4-22-16-10-8-15(9-11-16)21-18-12-14(3)20-19-13(2)6-5-7-17(18)19;/h5-12H,4H2,1-3H3,(H,20,21);1H |
| InChIKey | WOHXASLFYHUUHA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |