C12H13N3O — CID 741703
4-[(4,6-dimethylpyrimidin-2-yl)amino]phenol (PubChem CID 741703) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)amino]phenol.
| Compound Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]phenol |
|---|---|
| PubChem CID | 741703 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]phenol |
| SMILES | Cc1cc(C)nc(Nc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C12H13N3O/c1-8-7-9(2)14-12(13-8)15-10-3-5-11(16)6-4-10/h3-7,16H,1-2H3,(H,13,14,15) |
| InChIKey | NUWWAHKTVOVTNC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|