C20H20N4O2 — CID 108796510
4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(4-hydroxy-2-methylphenyl)benzamide (PubChem CID 108796510) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(4-hydroxy-2-methylphenyl)benzamide.
| Compound Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(4-hydroxy-2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 108796510 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(4-hydroxy-2-methylphenyl)benzamide |
| SMILES | Cc1cc(C)nc(Nc2ccc(C(=O)Nc3ccc(O)cc3C)cc2)n1 |
| InChI | InChI=1S/C20H20N4O2/c1-12-10-17(25)8-9-18(12)24-19(26)15-4-6-16(7-5-15)23-20-21-13(2)11-14(3)22-20/h4-11,25H,1-3H3,(H,24,26)(H,21,22,23) |
| InChIKey | CLLZPWXMLLCDSX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|