C23H25N5O2 — CID 108796605
N-(5-acetamido-2-ethylphenyl)-4-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide (PubChem CID 108796605) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is N-(5-acetamido-2-ethylphenyl)-4-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide.
| Compound Name | N-(5-acetamido-2-ethylphenyl)-4-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 108796605 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | N-(5-acetamido-2-ethylphenyl)-4-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide |
| SMILES | CCc1ccc(NC(C)=O)cc1NC(=O)c1ccc(Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C23H25N5O2/c1-5-17-6-11-20(26-16(4)29)13-21(17)28-22(30)18-7-9-19(10-8-18)27-23-24-14(2)12-15(3)25-23/h6-13H,5H2,1-4H3,(H,26,29)(H,28,30)(H,24,25,27) |
| InChIKey | DZGVFJLROXLEIS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |