C20H18N4O3 — CID 108807939
2-[[4-[(4,6-dimethylpyrimidin-2-yl)amino]benzoyl]amino]benzoic acid (PubChem CID 108807939) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-[[4-[(4,6-dimethylpyrimidin-2-yl)amino]benzoyl]amino]benzoic acid.
| Compound Name | 2-[[4-[(4,6-dimethylpyrimidin-2-yl)amino]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108807939 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-[[4-[(4,6-dimethylpyrimidin-2-yl)amino]benzoyl]amino]benzoic acid |
| SMILES | Cc1cc(C)nc(Nc2ccc(C(=O)Nc3ccccc3C(=O)O)cc2)n1 |
| InChI | InChI=1S/C20H18N4O3/c1-12-11-13(2)22-20(21-12)23-15-9-7-14(8-10-15)18(25)24-17-6-4-3-5-16(17)19(26)27/h3-11H,1-2H3,(H,24,25)(H,26,27)(H,21,22,23) |
| InChIKey | VFILXKMSHVMYEL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |