About 1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol
1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol (PubChem CID 168636994) has the molecular formula C15H19ClN4O
and a molecular weight of 306.80 g/mol. Its IUPAC name is 1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol.
Molecular Properties
| Compound Name | 1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol |
| PubChem CID | 168636994 |
| Molecular Formula | C15H19ClN4O |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol |
| SMILES | Cc1cc(C)nc(Nc2ccc(NCC(O)CCl)cc2)n1 |
| InChI | InChI=1S/C15H19ClN4O/c1-10-7-11(2)19-15(18-10)20-13-5-3-12(4-6-13)17-9-14(21)8-16/h3-7,14,17,21H,8-9H2,1-2H3,(H,18,19,20) |
| InChIKey | VIIHOUKSMYNWIT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol?
The IUPAC name of 1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol (CID 168636994) is 1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol.
What is the SMILES notation for 1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol?
The canonical SMILES for 1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol is Cc1cc(C)nc(Nc2ccc(NCC(O)CCl)cc2)n1.
What is the InChIKey of 1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol?
The InChIKey is VIIHOUKSMYNWIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19ClN4O/c1-10-7-11(2)19-15(18-10)20-13-5-3-12(4-6-13)17-9-14(21)8-16/h3-7,14,17,21H,8-9H2,1-2H3,(H,18,19,20).
What are the key properties of 1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol?
1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol has a molecular weight of 306.80 g/mol, XLogP of 2.85, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol is sourced from PubChem (CID 168636994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).