C15H19ClN4O — CID 168636994
1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol (PubChem CID 168636994) has the molecular formula C15H19ClN4O and a molecular weight of 306.80 g/mol. Its IUPAC name is 1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol.
| Compound Name | 1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol |
|---|---|
| PubChem CID | 168636994 |
| Molecular Formula | C15H19ClN4O |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-chloro-3-[4-[(4,6-dimethylpyrimidin-2-yl)amino]anilino]propan-2-ol |
| SMILES | Cc1cc(C)nc(Nc2ccc(NCC(O)CCl)cc2)n1 |
| InChI | InChI=1S/C15H19ClN4O/c1-10-7-11(2)19-15(18-10)20-13-5-3-12(4-6-13)17-9-14(21)8-16/h3-7,14,17,21H,8-9H2,1-2H3,(H,18,19,20) |
| InChIKey | VIIHOUKSMYNWIT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|