C24H38N12O8 — CID 21351792
3-[[4-[4-[[4,6-bis(2,3-dihydroxypropylamino)-1,3,5-triazin-2-yl]amino]anilino]-6-(2,3-dihydroxypropylamino)-1,3,5-triazin-2-yl]amino]propane-1,2-diol (PubChem CID 21351792) has the molecular formula C24H38N12O8 and a molecular weight of 622.64 g/mol. Its IUPAC name is 3-[[4-[4-[[4,6-bis(2,3-dihydroxypropylamino)-1,3,5-triazin-2-yl]amino]anilino]-6-(2,3-dihydroxypropylamino)-1,3,5-triazin-2-yl]amino]propane-1,2-diol.
| Compound Name | 3-[[4-[4-[[4,6-bis(2,3-dihydroxypropylamino)-1,3,5-triazin-2-yl]amino]anilino]-6-(2,3-dihydroxypropylamino)-1,3,5-triazin-2-yl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 21351792 |
| Molecular Formula | C24H38N12O8 |
| Molecular Weight | 622.64 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | 3-[[4-[4-[[4,6-bis(2,3-dihydroxypropylamino)-1,3,5-triazin-2-yl]amino]anilino]-6-(2,3-dihydroxypropylamino)-1,3,5-triazin-2-yl]amino]propane-1,2-diol |
| SMILES | OCC(O)CNc1nc(NCC(O)CO)nc(Nc2ccc(Nc3nc(NCC(O)CO)nc(NCC(O)CO)n3)cc2)n1 |
| InChI | InChI=1S/C24H38N12O8/c37-9-15(41)5-25-19-31-20(26-6-16(42)10-38)34-23(33-19)29-13-1-2-14(4-3-13)30-24-35-21(27-7-17(43)11-39)32-22(36-24)28-8-18(44)12-40/h1-4,15-18,37-44H,5-12H2,(H3,25,26,29,31,33,34)(H3,27,28,30,32,35,36) |
| InChIKey | QQHXBRUFNCLOSM-UHFFFAOYSA-N |
| XLogP | -3.40 |
| TPSA | 311.36 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.64 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 20 |