C11H13N3O2 — CID 114789175
3-(quinazolin-2-ylamino)propane-1,2-diol (PubChem CID 114789175) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-(quinazolin-2-ylamino)propane-1,2-diol.
| Compound Name | 3-(quinazolin-2-ylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 114789175 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3-(quinazolin-2-ylamino)propane-1,2-diol |
| SMILES | OCC(O)CNc1ncc2ccccc2n1 |
| InChI | InChI=1S/C11H13N3O2/c15-7-9(16)6-13-11-12-5-8-3-1-2-4-10(8)14-11/h1-5,9,15-16H,6-7H2,(H,12,13,14) |
| InChIKey | KHZWRYTVBOYSSI-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |