C10H12N4 — CID 114788771
N'-quinazolin-2-ylethane-1,2-diamine (PubChem CID 114788771) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is N'-quinazolin-2-ylethane-1,2-diamine.
| Compound Name | N'-quinazolin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 114788771 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | N'-quinazolin-2-ylethane-1,2-diamine |
| SMILES | NCCNc1ncc2ccccc2n1 |
| InChI | InChI=1S/C10H12N4/c11-5-6-12-10-13-7-8-3-1-2-4-9(8)14-10/h1-4,7H,5-6,11H2,(H,12,13,14) |
| InChIKey | REMLXLUGQDYBIY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |