C16H24N4 — CID 114788824
N',N'-di(propan-2-yl)-N-quinazolin-2-ylethane-1,2-diamine (PubChem CID 114788824) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is N',N'-di(propan-2-yl)-N-quinazolin-2-ylethane-1,2-diamine.
| Compound Name | N',N'-di(propan-2-yl)-N-quinazolin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 114788824 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | N',N'-di(propan-2-yl)-N-quinazolin-2-ylethane-1,2-diamine |
| SMILES | CC(C)N(CCNc1ncc2ccccc2n1)C(C)C |
| InChI | InChI=1S/C16H24N4/c1-12(2)20(13(3)4)10-9-17-16-18-11-14-7-5-6-8-15(14)19-16/h5-8,11-13H,9-10H2,1-4H3,(H,17,18,19) |
| InChIKey | ZQHBIGRJIJLYHJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |