C21H30LiN11O7S — CID 59172518
lithium 2-[[4-(2,3-dihydroxypropylamino)-6-[4-[[4-[ethylamino(hydroxy)methoxy]-6-methyl-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]ethanesulfonate (PubChem CID 59172518) has the molecular formula C21H30LiN11O7S and a molecular weight of 587.55 g/mol. Its IUPAC name is lithium 2-[[4-(2,3-dihydroxypropylamino)-6-[4-[[4-[ethylamino(hydroxy)methoxy]-6-methyl-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]ethanesulfonate.
| Compound Name | lithium 2-[[4-(2,3-dihydroxypropylamino)-6-[4-[[4-[ethylamino(hydroxy)methoxy]-6-methyl-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]ethanesulfonate |
|---|---|
| PubChem CID | 59172518 |
| Molecular Formula | C21H30LiN11O7S |
| Molecular Weight | 587.55 g/mol |
| Exact Mass | 587.22 |
| IUPAC Name | lithium 2-[[4-(2,3-dihydroxypropylamino)-6-[4-[[4-[ethylamino(hydroxy)methoxy]-6-methyl-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]ethanesulfonate |
| SMILES | CCNC(O)Oc1nc(C)nc(Nc2ccc(Nc3nc(NCCS(=O)(=O)[O-])nc(NCC(O)CO)n3)cc2)n1.[Li+] |
| InChI | InChI=1S/C21H31N11O7S.Li/c1-3-22-21(35)39-20-26-12(2)25-18(32-20)27-13-4-6-14(7-5-13)28-19-30-16(23-8-9-40(36,37)38)29-17(31-19)24-10-15(34)11-33;/h4-7,15,21-22,33-35H,3,8-11H2,1-2H3,(H,36,37,38)(H,25,26,27,32)(H3,23,24,28,29,30,31);/q;+1/p-1 |
| InChIKey | RDYQHZZJYBXPSE-UHFFFAOYSA-M |
| XLogP | -4.16 |
| TPSA | 264.61 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.55 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|