About 3-[4-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]anilino]propane-1,2-diol
3-[4-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]anilino]propane-1,2-diol (PubChem CID 168593288) has the molecular formula C17H24N4O2
and a molecular weight of 316.41 g/mol. Its IUPAC name is 3-[4-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]anilino]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[4-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]anilino]propane-1,2-diol |
| PubChem CID | 168593288 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 3-[4-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]anilino]propane-1,2-diol |
| SMILES | CCN(c1ccc(NCC(O)CO)cc1)c1nc(C)cc(C)n1 |
| InChI | InChI=1S/C17H24N4O2/c1-4-21(17-19-12(2)9-13(3)20-17)15-7-5-14(6-8-15)18-10-16(23)11-22/h5-9,16,18,22-23H,4,10-11H2,1-3H3 |
| InChIKey | VNKIGFHFEBMUFK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]anilino]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]anilino]propane-1,2-diol?
The IUPAC name of 3-[4-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]anilino]propane-1,2-diol (CID 168593288) is 3-[4-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]anilino]propane-1,2-diol.
What is the SMILES notation for 3-[4-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]anilino]propane-1,2-diol?
The canonical SMILES for 3-[4-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]anilino]propane-1,2-diol is CCN(c1ccc(NCC(O)CO)cc1)c1nc(C)cc(C)n1.
What is the InChIKey of 3-[4-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]anilino]propane-1,2-diol?
The InChIKey is VNKIGFHFEBMUFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O2/c1-4-21(17-19-12(2)9-13(3)20-17)15-7-5-14(6-8-15)18-10-16(23)11-22/h5-9,16,18,22-23H,4,10-11H2,1-3H3.
What are the key properties of 3-[4-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]anilino]propane-1,2-diol?
3-[4-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]anilino]propane-1,2-diol has a molecular weight of 316.41 g/mol, XLogP of 2.02, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(4,6-dimethylpyrimidin-2-yl)-ethylamino]anilino]propane-1,2-diol is sourced from PubChem (CID 168593288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).