C14H18N8 — CID 168602108
1-(diaminomethylidene)-2-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]guanidine (PubChem CID 168602108) has the molecular formula C14H18N8 and a molecular weight of 298.35 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]guanidine |
|---|---|
| PubChem CID | 168602108 |
| Molecular Formula | C14H18N8 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-(diaminomethylidene)-2-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]guanidine |
| SMILES | Cc1cc(C)nc(Nc2ccc(/N=C(\N)N=C(N)N)cc2)n1 |
| InChI | InChI=1S/C14H18N8/c1-8-7-9(2)19-14(18-8)21-11-5-3-10(4-6-11)20-13(17)22-12(15)16/h3-7H,1-2H3,(H,18,19,21)(H6,15,16,17,20,22) |
| InChIKey | LEPJWZZJKRXUAO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|