C24H21Cl3N8 — CID 162345185
5-chloro-N-[2,6-dichloro-4-[[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]diazenyl]phenyl]-4,6-dimethylpyrimidin-2-amine (PubChem CID 162345185) has the molecular formula C24H21Cl3N8 and a molecular weight of 527.85 g/mol. Its IUPAC name is 5-chloro-N-[2,6-dichloro-4-[[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]diazenyl]phenyl]-4,6-dimethylpyrimidin-2-amine.
| Compound Name | 5-chloro-N-[2,6-dichloro-4-[[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]diazenyl]phenyl]-4,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 162345185 |
| Molecular Formula | C24H21Cl3N8 |
| Molecular Weight | 527.85 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 5-chloro-N-[2,6-dichloro-4-[[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]diazenyl]phenyl]-4,6-dimethylpyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(Nc2ccc(/N=N/c3cc(Cl)c(Nc4nc(C)c(Cl)c(C)n4)c(Cl)c3)cc2)n1 |
| InChI | InChI=1S/C24H21Cl3N8/c1-12-9-13(2)29-23(28-12)32-16-5-7-17(8-6-16)34-35-18-10-19(25)22(20(26)11-18)33-24-30-14(3)21(27)15(4)31-24/h5-11H,1-4H3,(H,28,29,32)(H,30,31,33)/b35-34+ |
| InChIKey | HROFYCZGFOWIAB-XAHDOWKMSA-N |
| XLogP | 8.36 |
| TPSA | 100.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.85 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|