C32H24ClN9 — CID 89037912
6-chloro-2-N-(2-methyl-4-phenyldiazenylphenyl)-4-N-[4-(naphthalen-2-yldiazenyl)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 89037912) has the molecular formula C32H24ClN9 and a molecular weight of 570.06 g/mol. Its IUPAC name is 6-chloro-2-N-(2-methyl-4-phenyldiazenylphenyl)-4-N-[4-(naphthalen-2-yldiazenyl)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(2-methyl-4-phenyldiazenylphenyl)-4-N-[4-(naphthalen-2-yldiazenyl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 89037912 |
| Molecular Formula | C32H24ClN9 |
| Molecular Weight | 570.06 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 6-chloro-2-N-(2-methyl-4-phenyldiazenylphenyl)-4-N-[4-(naphthalen-2-yldiazenyl)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cc(/N=N/c2ccccc2)ccc1Nc1nc(Cl)nc(Nc2ccc(/N=N/c3ccc4ccccc4c3)cc2)n1 |
| InChI | InChI=1S/C32H24ClN9/c1-21-19-27(41-39-25-9-3-2-4-10-25)17-18-29(21)35-32-37-30(33)36-31(38-32)34-24-13-15-26(16-14-24)40-42-28-12-11-22-7-5-6-8-23(22)20-28/h2-20H,1H3,(H2,34,35,36,37,38)/b41-39+,42-40+ |
| InChIKey | PYCKWHGEIRJYJW-LMXNTIJMSA-N |
| XLogP | 10.30 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.06 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|