C18H20N8 — CID 90346186
2-N,2-N,6-N-trimethyl-4-N-(4-phenyldiazenylphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 90346186) has the molecular formula C18H20N8 and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-N,2-N,6-N-trimethyl-4-N-(4-phenyldiazenylphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,6-N-trimethyl-4-N-(4-phenyldiazenylphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 90346186 |
| Molecular Formula | C18H20N8 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-N,2-N,6-N-trimethyl-4-N-(4-phenyldiazenylphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(Nc2ccc(/N=N/c3ccccc3)cc2)nc(N(C)C)n1 |
| InChI | InChI=1S/C18H20N8/c1-19-16-21-17(23-18(22-16)26(2)3)20-13-9-11-15(12-10-13)25-24-14-7-5-4-6-8-14/h4-12H,1-3H3,(H2,19,20,21,22,23)/b25-24+ |
| InChIKey | RKYWLOMAHLETDC-OCOZRVBESA-N |
| XLogP | 4.14 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|