C36H38N14 — CID 102307503
4-N-[4-[[4-[[4-(3,5-dimethylanilino)-6-(methylamino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]phenyl]-2-N-(3,5-dimethylphenyl)-6-N-methyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 102307503) has the molecular formula C36H38N14 and a molecular weight of 666.80 g/mol. Its IUPAC name is 4-N-[4-[[4-[[4-(3,5-dimethylanilino)-6-(methylamino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]phenyl]-2-N-(3,5-dimethylphenyl)-6-N-methyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[4-[[4-[[4-(3,5-dimethylanilino)-6-(methylamino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]phenyl]-2-N-(3,5-dimethylphenyl)-6-N-methyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 102307503 |
| Molecular Formula | C36H38N14 |
| Molecular Weight | 666.80 g/mol |
| Exact Mass | 666.34 |
| IUPAC Name | 4-N-[4-[[4-[[4-(3,5-dimethylanilino)-6-(methylamino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]phenyl]-2-N-(3,5-dimethylphenyl)-6-N-methyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(Nc2ccc(/N=N/c3ccc(Nc4nc(NC)nc(Nc5cc(C)cc(C)c5)n4)cc3)cc2)nc(Nc2cc(C)cc(C)c2)n1 |
| InChI | InChI=1S/C36H38N14/c1-21-15-22(2)18-29(17-21)41-35-45-31(37-5)43-33(47-35)39-25-7-11-27(12-8-25)49-50-28-13-9-26(10-14-28)40-34-44-32(38-6)46-36(48-34)42-30-19-23(3)16-24(4)20-30/h7-20H,1-6H3,(H3,37,39,41,43,45,47)(H3,38,40,42,44,46,48)/b50-49+ |
| InChIKey | PNBJPGRPQRERRA-BNEIJSFPSA-N |
| XLogP | 8.76 |
| TPSA | 174.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.80 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|