C15H14N8 — CID 101453864
2-N-(4-phenyldiazenylphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 101453864) has the molecular formula C15H14N8 and a molecular weight of 306.33 g/mol. Its IUPAC name is 2-N-(4-phenyldiazenylphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(4-phenyldiazenylphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 101453864 |
| Molecular Formula | C15H14N8 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 2-N-(4-phenyldiazenylphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(N)nc(Nc2ccc(/N=N/c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C15H14N8/c16-13-19-14(17)21-15(20-13)18-10-6-8-12(9-7-10)23-22-11-4-2-1-3-5-11/h1-9H,(H5,16,17,18,19,20,21)/b23-22+ |
| InChIKey | XCCQHCBCCBVOFB-GHVJWSGMSA-N |
| XLogP | 3.19 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|