C36H28N12 — CID 136797949
N-[(4-phenyldiazenylphenyl)diazenyl]-4-[[4-[2-(4-phenyldiazenylphenyl)iminohydrazinyl]phenyl]diazenyl]aniline (PubChem CID 136797949) has the molecular formula C36H28N12 and a molecular weight of 628.70 g/mol. Its IUPAC name is N-[(4-phenyldiazenylphenyl)diazenyl]-4-[[4-[2-(4-phenyldiazenylphenyl)iminohydrazinyl]phenyl]diazenyl]aniline.
| Compound Name | N-[(4-phenyldiazenylphenyl)diazenyl]-4-[[4-[2-(4-phenyldiazenylphenyl)iminohydrazinyl]phenyl]diazenyl]aniline |
|---|---|
| PubChem CID | 136797949 |
| Molecular Formula | C36H28N12 |
| Molecular Weight | 628.70 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | N-[(4-phenyldiazenylphenyl)diazenyl]-4-[[4-[2-(4-phenyldiazenylphenyl)iminohydrazinyl]phenyl]diazenyl]aniline |
| SMILES | c1ccc(/N=N/c2ccc(/N=N/Nc3ccc(/N=N/c4ccc(N/N=N/c5ccc(/N=N/c6ccccc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H28N12/c1-3-7-27(8-4-1)37-39-29-11-19-33(20-12-29)43-47-45-35-23-15-31(16-24-35)41-42-32-17-25-36(26-18-32)46-48-44-34-21-13-30(14-22-34)40-38-28-9-5-2-6-10-28/h1-26H,(H,43,45)(H,44,46)/b39-37+,40-38+,42-41+ |
| InChIKey | NWHDIODDMVSVHO-GSZCCKEHSA-N |
| XLogP | 13.15 |
| TPSA | 147.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.70 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|