C18H15N5O2 — CID 136723444
2-[(4-phenyldiazenylanilino)diazenyl]benzene-1,3-diol (PubChem CID 136723444) has the molecular formula C18H15N5O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is 2-[(4-phenyldiazenylanilino)diazenyl]benzene-1,3-diol.
| Compound Name | 2-[(4-phenyldiazenylanilino)diazenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 136723444 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 2-[(4-phenyldiazenylanilino)diazenyl]benzene-1,3-diol |
| SMILES | Oc1cccc(O)c1/N=N/Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15N5O2/c24-16-7-4-8-17(25)18(16)22-23-21-15-11-9-14(10-12-15)20-19-13-5-2-1-3-6-13/h1-12,24-25H,(H,21,22)/b20-19+ |
| InChIKey | RJWCAGKYAPCQSE-FMQUCBEESA-N |
| XLogP | 5.62 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|