About diphenyldiazene;urea
diphenyldiazene;urea (PubChem CID 175083568) has the molecular formula C13H14N4O
and a molecular weight of 242.28 g/mol. Its IUPAC name is diphenyldiazene;urea.
Molecular Properties
| Compound Name | diphenyldiazene;urea |
| PubChem CID | 175083568 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | diphenyldiazene;urea |
| SMILES | NC(N)=O.c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10N2.CH4N2O/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;2-1(3)4/h1-10H;(H4,2,3,4)/b14-13+; |
| InChIKey | KGAXFWXWEUODPV-IERUDJENSA-N |
| XLogP | 3.13 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze diphenyldiazene;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyldiazene;urea?
The IUPAC name of diphenyldiazene;urea (CID 175083568) is diphenyldiazene;urea.
What is the SMILES notation for diphenyldiazene;urea?
The canonical SMILES for diphenyldiazene;urea is NC(N)=O.c1ccc(/N=N/c2ccccc2)cc1.
What is the InChIKey of diphenyldiazene;urea?
The InChIKey is KGAXFWXWEUODPV-IERUDJENSA-N. The full InChI is InChI=1S/C12H10N2.CH4N2O/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;2-1(3)4/h1-10H;(H4,2,3,4)/b14-13+;.
What are the key properties of diphenyldiazene;urea?
diphenyldiazene;urea has a molecular weight of 242.28 g/mol, XLogP of 3.13, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyldiazene;urea is sourced from PubChem (CID 175083568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).