About 4-phenyldiazenylbenzoic acid
4-phenyldiazenylbenzoic acid (PubChem CID 15276) has the molecular formula C13H10N2O2
and a molecular weight of 226.23 g/mol. Its IUPAC name is 4-phenyldiazenylbenzoic acid.
Molecular Properties
| Compound Name | 4-phenyldiazenylbenzoic acid |
| PubChem CID | 15276 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 4-phenyldiazenylbenzoic acid |
| SMILES | O=C(O)c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C13H10N2O2/c16-13(17)10-6-8-12(9-7-10)15-14-11-4-2-1-3-5-11/h1-9H,(H,16,17)/b15-14+ |
| InChIKey | CSPTZWQFHBVOLO-CCEZHUSRSA-N |
| XLogP | 3.80 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyldiazenylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyldiazenylbenzoic acid?
The IUPAC name of 4-phenyldiazenylbenzoic acid (CID 15276) is 4-phenyldiazenylbenzoic acid.
What is the SMILES notation for 4-phenyldiazenylbenzoic acid?
The canonical SMILES for 4-phenyldiazenylbenzoic acid is O=C(O)c1ccc(/N=N/c2ccccc2)cc1.
What is the InChIKey of 4-phenyldiazenylbenzoic acid?
The InChIKey is CSPTZWQFHBVOLO-CCEZHUSRSA-N. The full InChI is InChI=1S/C13H10N2O2/c16-13(17)10-6-8-12(9-7-10)15-14-11-4-2-1-3-5-11/h1-9H,(H,16,17)/b15-14+.
What are the key properties of 4-phenyldiazenylbenzoic acid?
4-phenyldiazenylbenzoic acid has a molecular weight of 226.23 g/mol, XLogP of 3.80, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyldiazenylbenzoic acid is sourced from PubChem (CID 15276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).