C22H18N4O4 — CID 177296906
4-[[4-[(4-carboxyphenyl)diazenyl]-2,5-dimethylphenyl]diazenyl]benzoic acid (PubChem CID 177296906) has the molecular formula C22H18N4O4 and a molecular weight of 402.41 g/mol. Its IUPAC name is 4-[[4-[(4-carboxyphenyl)diazenyl]-2,5-dimethylphenyl]diazenyl]benzoic acid.
| Compound Name | 4-[[4-[(4-carboxyphenyl)diazenyl]-2,5-dimethylphenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 177296906 |
| Molecular Formula | C22H18N4O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 4-[[4-[(4-carboxyphenyl)diazenyl]-2,5-dimethylphenyl]diazenyl]benzoic acid |
| SMILES | Cc1cc(/N=N/c2ccc(C(=O)O)cc2)c(C)cc1/N=N/c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H18N4O4/c1-13-11-20(26-24-18-9-5-16(6-10-18)22(29)30)14(2)12-19(13)25-23-17-7-3-15(4-8-17)21(27)28/h3-12H,1-2H3,(H,27,28)(H,29,30)/b25-23+,26-24+ |
| InChIKey | XCNFISXYBSKBOM-OGGGYYITSA-N |
| XLogP | 6.53 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|