C19H22N2O3 — CID 135722125
4-[[2-(2,3-dimethylbutyl)-4-hydroxyphenyl]diazenyl]benzoic acid (PubChem CID 135722125) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 4-[[2-(2,3-dimethylbutyl)-4-hydroxyphenyl]diazenyl]benzoic acid.
| Compound Name | 4-[[2-(2,3-dimethylbutyl)-4-hydroxyphenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 135722125 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 4-[[2-(2,3-dimethylbutyl)-4-hydroxyphenyl]diazenyl]benzoic acid |
| SMILES | CC(C)C(C)Cc1cc(O)ccc1/N=N/c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H22N2O3/c1-12(2)13(3)10-15-11-17(22)8-9-18(15)21-20-16-6-4-14(5-7-16)19(23)24/h4-9,11-13,22H,10H2,1-3H3,(H,23,24)/b21-20+ |
| InChIKey | PCYDKVPYGZLRDZ-QZQOTICOSA-N |
| XLogP | 5.34 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|