C27H34N2O3 — CID 11419132
4-[[5-hydroxy-2-[(8Z,10Z)-tetradeca-8,10-dienyl]phenyl]diazenyl]benzoic acid (PubChem CID 11419132) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is 4-[[5-hydroxy-2-[(8Z,10Z)-tetradeca-8,10-dienyl]phenyl]diazenyl]benzoic acid.
| Compound Name | 4-[[5-hydroxy-2-[(8Z,10Z)-tetradeca-8,10-dienyl]phenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 11419132 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 4-[[5-hydroxy-2-[(8Z,10Z)-tetradeca-8,10-dienyl]phenyl]diazenyl]benzoic acid |
| SMILES | CCC/C=C\C=C/CCCCCCCc1ccc(O)cc1/N=N/c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C27H34N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-22-17-20-25(30)21-26(22)29-28-24-18-15-23(16-19-24)27(31)32/h4-7,15-21,30H,2-3,8-14H2,1H3,(H,31,32)/b5-4-,7-6-,29-28+ |
| InChIKey | YVNFJYCUARHWFK-ZARWWILXSA-N |
| XLogP | 8.30 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|