C33H44N2O4 — CID 59927745
4-[[4-(2-methylbutanoyloxy)-2-[(8Z,11Z)-pentadeca-8,11-dienyl]phenyl]diazenyl]benzoic acid (PubChem CID 59927745) has the molecular formula C33H44N2O4 and a molecular weight of 532.73 g/mol. Its IUPAC name is 4-[[4-(2-methylbutanoyloxy)-2-[(8Z,11Z)-pentadeca-8,11-dienyl]phenyl]diazenyl]benzoic acid.
| Compound Name | 4-[[4-(2-methylbutanoyloxy)-2-[(8Z,11Z)-pentadeca-8,11-dienyl]phenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 59927745 |
| Molecular Formula | C33H44N2O4 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | 4-[[4-(2-methylbutanoyloxy)-2-[(8Z,11Z)-pentadeca-8,11-dienyl]phenyl]diazenyl]benzoic acid |
| SMILES | CCC/C=C\C/C=C\CCCCCCCc1cc(OC(=O)C(C)CC)ccc1/N=N/c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C33H44N2O4/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-28-25-30(39-33(38)26(3)5-2)23-24-31(28)35-34-29-21-19-27(20-22-29)32(36)37/h7-8,10-11,19-26H,4-6,9,12-18H2,1-3H3,(H,36,37)/b8-7-,11-10-,35-34+ |
| InChIKey | LXXQZARXQXDMEI-ZZQNDJHQSA-N |
| XLogP | 9.94 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|