C23H26N2O5 — CID 173048561
4-[[4-(8-carboxynon-7-enoxy)phenyl]diazenyl]benzoic acid (PubChem CID 173048561) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-[[4-(8-carboxynon-7-enoxy)phenyl]diazenyl]benzoic acid.
| Compound Name | 4-[[4-(8-carboxynon-7-enoxy)phenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 173048561 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 4-[[4-(8-carboxynon-7-enoxy)phenyl]diazenyl]benzoic acid |
| SMILES | CC(=CCCCCCCOc1ccc(/N=N/c2ccc(C(=O)O)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C23H26N2O5/c1-17(22(26)27)7-5-3-2-4-6-16-30-21-14-12-20(13-15-21)25-24-19-10-8-18(9-11-19)23(28)29/h7-15H,2-6,16H2,1H3,(H,26,27)(H,28,29)/b17-7?,25-24+ |
| InChIKey | JEPNIXWODOZNBJ-PVQJGDCPSA-N |
| XLogP | 6.16 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|