C53H66N4O6 — CID 142737188
3,5-bis[6-[4-[(4-pentylphenyl)diazenyl]phenoxy]hexoxy]benzoic acid (PubChem CID 142737188) has the molecular formula C53H66N4O6 and a molecular weight of 855.13 g/mol. Its IUPAC name is 3,5-bis[6-[4-[(4-pentylphenyl)diazenyl]phenoxy]hexoxy]benzoic acid.
| Compound Name | 3,5-bis[6-[4-[(4-pentylphenyl)diazenyl]phenoxy]hexoxy]benzoic acid |
|---|---|
| PubChem CID | 142737188 |
| Molecular Formula | C53H66N4O6 |
| Molecular Weight | 855.13 g/mol |
| Exact Mass | 854.50 |
| IUPAC Name | 3,5-bis[6-[4-[(4-pentylphenyl)diazenyl]phenoxy]hexoxy]benzoic acid |
| SMILES | CCCCCc1ccc(/N=N/c2ccc(OCCCCCCOc3cc(OCCCCCCOc4ccc(/N=N/c5ccc(CCCCC)cc5)cc4)cc(C(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C53H66N4O6/c1-3-5-11-17-42-19-23-45(24-20-42)54-56-47-27-31-49(32-28-47)60-35-13-7-9-15-37-62-51-39-44(53(58)59)40-52(41-51)63-38-16-10-8-14-36-61-50-33-29-48(30-34-50)57-55-46-25-21-43(22-26-46)18-12-6-4-2/h19-34,39-41H,3-18,35-38H2,1-2H3,(H,58,59)/b56-54+,57-55+ |
| InChIKey | SFMLQSFNSQGUPG-RMDWEAKOSA-N |
| XLogP | 15.72 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.13 |
| LogP ≤ 5 | 15.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|