C26H35N2NaO3 — CID 102039493
sodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate (PubChem CID 102039493) has the molecular formula C26H35N2NaO3 and a molecular weight of 446.57 g/mol. Its IUPAC name is sodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate.
| Compound Name | sodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate |
|---|---|
| PubChem CID | 102039493 |
| Molecular Formula | C26H35N2NaO3 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | sodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate |
| SMILES | CCCCCCCCc1ccc(/N=N/c2ccc(OCCCCCC(=O)[O-])cc2)cc1.[Na+] |
| InChI | InChI=1S/C26H36N2O3.Na/c1-2-3-4-5-6-8-11-22-13-15-23(16-14-22)27-28-24-17-19-25(20-18-24)31-21-10-7-9-12-26(29)30;/h13-20H,2-12,21H2,1H3,(H,29,30);/q;+1/p-1/b28-27+; |
| InChIKey | CTILCQSRZUYLQR-RXQWRGDBSA-M |
| XLogP | 3.70 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|