sodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate

C26H35N2NaO3 — CID 102039493

IUPACsodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate
SMILESCCCCCCCCc1ccc(/N=N/c2ccc(OCCCCCC(=O)[O-])cc2)cc1.[Na+]
InChIInChI=1S/C26H36N2O3.Na/c1-2-3-4-5-6-8-11-22-13-15-23(16-14-22)27-28-24-17-19-25(20-18-24)31-21-10-7-9-12-26(29)30;/h13-20H,2-12,21H2,1H3,(H,29,30);/q;+1/p-1/b28-27+;
InChIKeyCTILCQSRZUYLQR-RXQWRGDBSA-M
MW446.57 g/mol
LogP3.70
Rot. Bonds16

About sodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate

sodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate (PubChem CID 102039493) has the molecular formula C26H35N2NaO3 and a molecular weight of 446.57 g/mol. Its IUPAC name is sodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate.

Molecular Properties

Compound Namesodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate
PubChem CID102039493
Molecular FormulaC26H35N2NaO3
Molecular Weight446.57 g/mol
Exact Mass446.25
IUPAC Namesodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate
SMILESCCCCCCCCc1ccc(/N=N/c2ccc(OCCCCCC(=O)[O-])cc2)cc1.[Na+]
InChIInChI=1S/C26H36N2O3.Na/c1-2-3-4-5-6-8-11-22-13-15-23(16-14-22)27-28-24-17-19-25(20-18-24)31-21-10-7-9-12-26(29)30;/h13-20H,2-12,21H2,1H3,(H,29,30);/q;+1/p-1/b28-27+;
InChIKeyCTILCQSRZUYLQR-RXQWRGDBSA-M
XLogP3.70
TPSA74.08 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds16
Heavy Atoms32
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500446.57
LogP ≤ 53.70
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}

Analyze sodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate?
The IUPAC name of sodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate (CID 102039493) is sodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate.
What is the SMILES notation for sodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate?
The canonical SMILES for sodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate is CCCCCCCCc1ccc(/N=N/c2ccc(OCCCCCC(=O)[O-])cc2)cc1.[Na+].
What is the InChIKey of sodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate?
The InChIKey is CTILCQSRZUYLQR-RXQWRGDBSA-M. The full InChI is InChI=1S/C26H36N2O3.Na/c1-2-3-4-5-6-8-11-22-13-15-23(16-14-22)27-28-24-17-19-25(20-18-24)31-21-10-7-9-12-26(29)30;/h13-20H,2-12,21H2,1H3,(H,29,30);/q;+1/p-1/b28-27+;.
What are the key properties of sodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate?
sodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate has a molecular weight of 446.57 g/mol, XLogP of 3.70, 16 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoate is sourced from PubChem (CID 102039493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).