C26H36N2O3 — CID 56996290
6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoic acid (PubChem CID 56996290) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoic acid.
| Compound Name | 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 56996290 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 6-[4-[(4-octylphenyl)diazenyl]phenoxy]hexanoic acid |
| SMILES | CCCCCCCCc1ccc(/N=N/c2ccc(OCCCCCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C26H36N2O3/c1-2-3-4-5-6-8-11-22-13-15-23(16-14-22)27-28-24-17-19-25(20-18-24)31-21-10-7-9-12-26(29)30/h13-20H,2-12,21H2,1H3,(H,29,30)/b28-27+ |
| InChIKey | DBJNNKLRHNTZGJ-BYYHNAKLSA-N |
| XLogP | 8.03 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|