C54H58N4O6 — CID 132609961
[4-[4-[5-[4-[(4-butylphenyl)diazenyl]phenoxy]pentanoyloxy]phenyl]phenyl] 5-[4-[(4-butylphenyl)diazenyl]phenoxy]pentanoate (PubChem CID 132609961) has the molecular formula C54H58N4O6 and a molecular weight of 859.08 g/mol. Its IUPAC name is [4-[4-[5-[4-[(4-butylphenyl)diazenyl]phenoxy]pentanoyloxy]phenyl]phenyl] 5-[4-[(4-butylphenyl)diazenyl]phenoxy]pentanoate.
| Compound Name | [4-[4-[5-[4-[(4-butylphenyl)diazenyl]phenoxy]pentanoyloxy]phenyl]phenyl] 5-[4-[(4-butylphenyl)diazenyl]phenoxy]pentanoate |
|---|---|
| PubChem CID | 132609961 |
| Molecular Formula | C54H58N4O6 |
| Molecular Weight | 859.08 g/mol |
| Exact Mass | 858.44 |
| IUPAC Name | [4-[4-[5-[4-[(4-butylphenyl)diazenyl]phenoxy]pentanoyloxy]phenyl]phenyl] 5-[4-[(4-butylphenyl)diazenyl]phenoxy]pentanoate |
| SMILES | CCCCc1ccc(/N=N/c2ccc(OCCCCC(=O)Oc3ccc(-c4ccc(OC(=O)CCCCOc5ccc(/N=N/c6ccc(CCCC)cc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C54H58N4O6/c1-3-5-11-41-15-23-45(24-16-41)55-57-47-27-35-49(36-28-47)61-39-9-7-13-53(59)63-51-31-19-43(20-32-51)44-21-33-52(34-22-44)64-54(60)14-8-10-40-62-50-37-29-48(30-38-50)58-56-46-25-17-42(18-26-46)12-6-4-2/h15-38H,3-14,39-40H2,1-2H3/b57-55+,58-56+ |
| InChIKey | QNPQLDORZNMKKY-NCCSDIRBSA-N |
| XLogP | 15.18 |
| TPSA | 120.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.08 |
| LogP ≤ 5 | 15.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|