C52H56N4O6 — CID 132609964
[4-[5-[4-[(4-butylphenyl)diazenyl]phenoxy]pentanoyloxy]naphthalen-2-yl] 5-[4-[(4-butylphenyl)diazenyl]phenoxy]pentanoate (PubChem CID 132609964) has the molecular formula C52H56N4O6 and a molecular weight of 833.04 g/mol. Its IUPAC name is [4-[5-[4-[(4-butylphenyl)diazenyl]phenoxy]pentanoyloxy]naphthalen-2-yl] 5-[4-[(4-butylphenyl)diazenyl]phenoxy]pentanoate.
| Compound Name | [4-[5-[4-[(4-butylphenyl)diazenyl]phenoxy]pentanoyloxy]naphthalen-2-yl] 5-[4-[(4-butylphenyl)diazenyl]phenoxy]pentanoate |
|---|---|
| PubChem CID | 132609964 |
| Molecular Formula | C52H56N4O6 |
| Molecular Weight | 833.04 g/mol |
| Exact Mass | 832.42 |
| IUPAC Name | [4-[5-[4-[(4-butylphenyl)diazenyl]phenoxy]pentanoyloxy]naphthalen-2-yl] 5-[4-[(4-butylphenyl)diazenyl]phenoxy]pentanoate |
| SMILES | CCCCc1ccc(/N=N/c2ccc(OCCCCC(=O)Oc3cc(OC(=O)CCCCOc4ccc(/N=N/c5ccc(CCCC)cc5)cc4)c4ccccc4c3)cc2)cc1 |
| InChI | InChI=1S/C52H56N4O6/c1-3-5-13-39-19-23-42(24-20-39)53-55-44-27-31-46(32-28-44)59-35-11-9-17-51(57)61-48-37-41-15-7-8-16-49(41)50(38-48)62-52(58)18-10-12-36-60-47-33-29-45(30-34-47)56-54-43-25-21-40(22-26-43)14-6-4-2/h7-8,15-16,19-34,37-38H,3-6,9-14,17-18,35-36H2,1-2H3/b55-53+,56-54+ |
| InChIKey | SEUFNSMWNGTJGN-DSZBTAPASA-N |
| XLogP | 14.67 |
| TPSA | 120.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.04 |
| LogP ≤ 5 | 14.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|