C28H38N2O4 — CID 101221648
[7-oxo-4-[(4-pentoxyphenyl)diazenyl]cyclohepta-1,3,5-trien-1-yl] decanoate (PubChem CID 101221648) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is [7-oxo-4-[(4-pentoxyphenyl)diazenyl]cyclohepta-1,3,5-trien-1-yl] decanoate.
| Compound Name | [7-oxo-4-[(4-pentoxyphenyl)diazenyl]cyclohepta-1,3,5-trien-1-yl] decanoate |
|---|---|
| PubChem CID | 101221648 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | [7-oxo-4-[(4-pentoxyphenyl)diazenyl]cyclohepta-1,3,5-trien-1-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)Oc1ccc(/N=N/c2ccc(OCCCCC)cc2)ccc1=O |
| InChI | InChI=1S/C28H38N2O4/c1-3-5-7-8-9-10-11-13-28(32)34-27-21-17-24(16-20-26(27)31)30-29-23-14-18-25(19-15-23)33-22-12-6-4-2/h14-21H,3-13,22H2,1-2H3/b30-29+ |
| InChIKey | GYQOCLBFOXNDHN-QVIHXGFCSA-N |
| XLogP | 8.08 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|