C44H46O12 — CID 101359664
bis[4-(4-butoxybenzoyl)oxy-7-oxocyclohepta-1,3,5-trien-1-yl] octanedioate (PubChem CID 101359664) has the molecular formula C44H46O12 and a molecular weight of 766.84 g/mol. Its IUPAC name is bis[4-(4-butoxybenzoyl)oxy-7-oxocyclohepta-1,3,5-trien-1-yl] octanedioate.
| Compound Name | bis[4-(4-butoxybenzoyl)oxy-7-oxocyclohepta-1,3,5-trien-1-yl] octanedioate |
|---|---|
| PubChem CID | 101359664 |
| Molecular Formula | C44H46O12 |
| Molecular Weight | 766.84 g/mol |
| Exact Mass | 766.30 |
| IUPAC Name | bis[4-(4-butoxybenzoyl)oxy-7-oxocyclohepta-1,3,5-trien-1-yl] octanedioate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(OC(=O)CCCCCCC(=O)Oc3ccc(OC(=O)c4ccc(OCCCC)cc4)ccc3=O)c(=O)cc2)cc1 |
| InChI | InChI=1S/C44H46O12/c1-3-5-29-51-33-17-13-31(14-18-33)43(49)53-35-21-25-37(45)39(27-23-35)55-41(47)11-9-7-8-10-12-42(48)56-40-28-24-36(22-26-38(40)46)54-44(50)32-15-19-34(20-16-32)52-30-6-4-2/h13-28H,3-12,29-30H2,1-2H3 |
| InChIKey | URMBDUHNFPTRPO-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.84 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|