C44H50N2O8 — CID 102212815
(4-octoxy-7-oxocyclohepta-1,3,5-trien-1-yl) 4-[[4-(4-octoxy-7-oxocyclohepta-1,3,5-trien-1-yl)oxycarbonylphenyl]diazenyl]benzoate (PubChem CID 102212815) has the molecular formula C44H50N2O8 and a molecular weight of 734.89 g/mol. Its IUPAC name is (4-octoxy-7-oxocyclohepta-1,3,5-trien-1-yl) 4-[[4-(4-octoxy-7-oxocyclohepta-1,3,5-trien-1-yl)oxycarbonylphenyl]diazenyl]benzoate.
| Compound Name | (4-octoxy-7-oxocyclohepta-1,3,5-trien-1-yl) 4-[[4-(4-octoxy-7-oxocyclohepta-1,3,5-trien-1-yl)oxycarbonylphenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 102212815 |
| Molecular Formula | C44H50N2O8 |
| Molecular Weight | 734.89 g/mol |
| Exact Mass | 734.36 |
| IUPAC Name | (4-octoxy-7-oxocyclohepta-1,3,5-trien-1-yl) 4-[[4-(4-octoxy-7-oxocyclohepta-1,3,5-trien-1-yl)oxycarbonylphenyl]diazenyl]benzoate |
| SMILES | CCCCCCCCOc1ccc(OC(=O)c2ccc(/N=N/c3ccc(C(=O)Oc4ccc(OCCCCCCCC)ccc4=O)cc3)cc2)c(=O)cc1 |
| InChI | InChI=1S/C44H50N2O8/c1-3-5-7-9-11-13-31-51-37-23-27-39(47)41(29-25-37)53-43(49)33-15-19-35(20-16-33)45-46-36-21-17-34(18-22-36)44(50)54-42-30-26-38(24-28-40(42)48)52-32-14-12-10-8-6-4-2/h15-30H,3-14,31-32H2,1-2H3/b46-45+ |
| InChIKey | WMPPSMYOZQYDKP-XVIFHXHVSA-N |
| XLogP | 10.74 |
| TPSA | 129.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.89 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|